(R)-(-)-Phenylephrine hydrochloride , 99% , 61-76-7
Synonym(s):
(R)-(−)-1-(3-Hydroxyphenyl)-2-methylaminoethanol hydrochloride;(R)-(−)-3-Hydroxy-α-(methylaminomethyl)benzyl alcohol hydrochloride;(R)-(−)-Phenylephrine hydrochloride;PHE
CAS NO.:61-76-7
Empirical Formula: C9H13NO2.ClH
Molecular Weight: 203.67
MDL number: MFCD00012605
EINECS: 200-517-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB69.60 | In Stock |
|
| 10G | RMB79.20 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 50G | RMB311.20 | In Stock |
|
| 100G | RMB615.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 143-145 °C(lit.) |
| alpha | -47 º (c=2, H2O) |
| Density | 1.2652 g/cm³(Temp: 25 °C; Press: 750 Torr) |
| refractive index | -45.5 ° (C=1, H2O) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water and in ethanol (96 per cent). |
| form | Crystalline Powder |
| pka | pK1 8.77; pK2 9.84(at 25℃) |
| color | White to almost white |
| PH | pH (10g/L, 25℃) : 4.5~5.5 |
| Water Solubility | >=10 g/100 mL at 21 ºC |
| Merck | 14,7286 |
| BRN | 4158948 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C9H13NO2.ClH/c1-10-6-9(12)7-3-2-4-8(11)5-7;/h2-5,9-12H,6H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | OCYSGIYOVXAGKQ-FVGYRXGTSA-N |
| SMILES | OC1=CC([C@H](CNC)O)=CC=C1.Cl |
| LogP | -0.310 |
| CAS DataBase Reference | 61-76-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phenylephrine hydrochloride (61-76-7) |
Description and Uses
R-(-)-Phenylephrine is an adrenergic α1A receptor agonist (Ki = 1.4 μM) that demonstrates selectivity against the α1B and α1C receptor subtypes (Kis = 23.9 and 47.8 μM, respectively). By stimulating adrenergic α1 receptors, L-phenylephrine can induce aortic smooth muscle contractions, although reported relative affinity and potency values in rabbit are 5-fold weaker compared to that of L-norepinephrine . This compound is frequently used to precontract smooth muscle in preparations designed to study the properties of various vasodilator agents.
(R)-Phenylephrine Hydrochloride is an α-Adrenergic agonist. Mydriatic; decongestant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317 |
| Precautionary statements | P261-P264-P270-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36-37/39-45-36/37-16-7 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | DO7525000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1B |
| Toxicity | LD50 in rats (mg/kg): 17 ±1.1 i.p.; 33 ±2.0 s.c. (Warren, Werner) |







