A6660412
Potassium hexachloroosmate(IV) , Os38.7% , 16871-60-6
Synonym(s):
Osmium potassium chloride
CAS NO.:16871-60-6
Empirical Formula: Cl6K2Os
Molecular Weight: 481.14
MDL number: MFCD00011371
EINECS: 240-893-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB270.40 | In Stock |
|
| 1G | RMB766.40 | In Stock |
|
| 5G | RMB2718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 600 °C (dec.)(lit.) |
| Density | 3.42 g/mL at 25 °C(lit.) |
| storage temp. | Store at room temperature |
| solubility | very soluble in H2O; slightly soluble in ethanol |
| form | Powder |
| color | Dark red |
| Specific Gravity | 3.420 |
| Water Solubility | Soluble in water. Sparingly soluble in alcohol |
| Sensitive | Hygroscopic |
| Merck | 14,7635 |
| Stability: | hygroscopic |
| InChI | InChI=1S/6ClH.K.Os/h6*1H;;/q;;;;;;+1;+4/p-6 |
| InChIKey | GLNFCKPPRONDMA-UHFFFAOYSA-H |
| SMILES | [Os+4]([Cl-])([Cl-])([Cl-])([Cl-])([Cl-])[Cl-].[K+] |
| CAS DataBase Reference | 16871-60-6(CAS DataBase Reference) |
| EPA Substance Registry System | Osmate(2-), hexachloro-, dipotassium, (OC-6-11)- (16871-60-6) |
Description and Uses
Potassium hexachloroosmate(IV) used as Pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 3290 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28439090 |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |






