A6661712
Potassium thioacetate , 98% , 10387-40-3
Synonym(s):
Ethanethioic acid potassium salt;Potassium thioacetate;Thioacetic acid potassium salt;Thiolacetic acid potassium salt
CAS NO.：10387-40-3
Empirical Formula: C2H3KOS
Molecular Weight: 114.21
MDL number: MFCD00137704
EINECS: 233-848-7
| Pack Size | Price | Stock | Quantity |
| 100G | RMB72.80 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 500G | RMB224.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-176 °C (lit.) |
| bulk density | 500kg/m3 |
| Density | 1.58 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble |
| form | Crystalline Powder, Crystals or Chunks |
| pka | 3.6 |
| color | White to light brown |
| Water Solubility | soluble |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sensitive | Air Sensitive & Hygroscopic |
| BRN | 3595448 |
| InChI | InChI=1S/C2H4OS.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | AFNBMGLGYSGFEZ-UHFFFAOYSA-M |
| SMILES | C([S-])(=O)C.[K+] |
| CAS DataBase Reference | 10387-40-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanethioic acid, potassium salt (10387-40-3) |
Description and Uses
Potassium thioacetate is used for palladium mediated coupling with aryl halides and triflates leading to S-arylthioacetates and derivatives. It is also used as a reagent in the conversion of halides to thiols.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 3-9-13-23 |
| TSCA | Yes |
| HazardClass | 9 |
| HS Code | 29309070 |
