A6665112
Pyridinium p-toluenesulfonate , 98% , 24057-28-1
Synonym(s):
p-Toluenesulfonic acid pyridine salt;PPTS;Pyridine p-toluenesulfonate;Pyridinium 4-toluenesulfonate
CAS NO.:24057-28-1
Empirical Formula: C12H13NO3S
Molecular Weight: 251.3
MDL number: MFCD00013108
EINECS: 246-002-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 250G | RMB199.20 | In Stock |
|
| 500G | RMB364.00 | In Stock |
|
| 2.5kg | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-120 °C |
| Density | 1.2829 (rough estimate) |
| vapor pressure | 40Pa at 20℃ |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder or Crystals |
| color | White to light beige |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 3764305 |
| InChI | InChI=1S/C7H8O3S.C5H5N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-6-5-3-1/h2-5H,1H3,(H,8,9,10);1-5H |
| InChIKey | ZDYVRSLAEXCVBX-UHFFFAOYSA-N |
| SMILES | C1(S(=O)(=O)O)C=CC(C)=CC=1.C1=CC=NC=C1 |
| CAS DataBase Reference | 24057-28-1(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridinium p-toluenesulfonate (24057-28-1) |
Description and Uses
Pyridinium p-Toluenesulfate is used in the synthesis of a subdomain of the cytochrome P450 BM3 enzyme, for use in screening systems for drug candidates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 9-21 |
| TSCA | TSCA listed |
| HS Code | 29333100 |
| Storage Class | 11 - Combustible Solids |






