A6666412
3,5-Pyridinedicarboxylic acid , 98% , 499-81-0
Synonym(s):
Dinicotinic acid
CAS NO.:499-81-0
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00006393
EINECS: 207-893-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB296.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| Density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 1.0g/l |
| form | Powder |
| pka | 2.8(at 25℃) |
| color | White to almost white |
| Water Solubility | insoluble |
| BRN | 131640 |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | MPFLRYZEEAQMLQ-UHFFFAOYSA-N |
| SMILES | C1=NC=C(C(O)=O)C=C1C(O)=O |
| CAS DataBase Reference | 499-81-0(CAS DataBase Reference) |
Description and Uses
3,5-Pyridinedicarboxylic Acid is a competitive inhibitor of butyrobetaine hydroxylase. It is also used as organic synthesis and pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



