A6667012
1-Pyrenebutyric acid , 98% , 3443-45-6
Synonym(s):
4-(1-Pyrenyl)butyric acid;4-(1-Pyrenyl)-butyric acid;PyBA
CAS NO.:3443-45-6
Empirical Formula: C20H16O2
Molecular Weight: 288.34
MDL number: MFCD00004141
EINECS: 222-354-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB140.00 | In Stock |
|
| 5G | RMB532.00 | In Stock |
|
| 25G | RMB2123.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-186 °C (lit.) |
| Boiling point: | 370.57°C (rough estimate) |
| Density | 1.1742 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 4.76±0.10(Predicted) |
| form | Crystalline Powder |
| color | Pale yellow or yellow-beige |
| Appearance | off white solid |
| Water Solubility | Partially soluble in water. |
| BRN | 2140554 |
| InChI | InChI=1S/C20H16O2/c21-18(22)6-2-3-13-7-8-16-10-9-14-4-1-5-15-11-12-17(13)20(16)19(14)15/h1,4-5,7-12H,2-3,6H2,(H,21,22) |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1(CCCC(O)=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| CAS DataBase Reference | 3443-45-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Pyrenebutanoic acid (3443-45-6) |
Description and Uses
Pyrenylbutyric acid is a derivative of pyrene hydrocarbon with a free carboxylic acid function. The reagent is useful as a control for experiments with other reactive pyrene derivatives such as pyrene NHS ester and pyrene azide. Carboxylic acid function can be activated by carbodiimides and other activating reagents.
1-Pyrenebutyric Acid is a fluorescent probe used to study proteins, lipids, nucleic acids and other biological systems. The fluorescence lifetime of 1-Pyrenebutyric Acid depends on local oxygen and free radical concentration.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2916 39 90 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




