A6668912
Phosphonitrilic chloride trimer , 98% , 940-71-6
Synonym(s):
1,3,5,2,4,6-Triazatriphosphorine-2,2,4,4,6,6-hexachloride;1,3,5-Triaza-2,4,6-triphosphorin-2,2,4,4,6,6-hexachloride;Hexachlorocyclotriphosphazene
CAS NO.:940-71-6
Empirical Formula: Cl6N3P3
Molecular Weight: 347.66
MDL number: MFCD00006474
EINECS: 213-376-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB209.60 | In Stock |
|
| 500G | RMB735.20 | In Stock |
|
| 2.5kg | RMB2264.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-115 °C(lit.) |
| Boiling point: | 127 °C (13 mmHg) |
| Density | 1.98 g/mL at 25 °C(lit.) |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Insoluble in water |
| solubility | reacts with H2O |
| pka | -12.98±0.10(Predicted) |
| form | crystal |
| Specific Gravity | 1.98 |
| color | white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/Cl6N3P3/c1-8-10(3)7-12(5,6)9(2)11(8)4 |
| InChIKey | GIDDTSHDTGZRPQ-UHFFFAOYSA-N |
| SMILES | P1(Cl)(Cl)N(Cl)P(Cl)N(Cl)P(Cl)N=1 |
| CAS DataBase Reference | 940-71-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4,6,6-hexachloro-2,2,4,4,6,6-hexahydro-(940-71-6) |
| EPA Substance Registry System | 1,3,5,2,4,6-Triazatriphosphorine, 2,2,4,4,6,6-hexachloro-2,2,4,4,6,6-hexahydro- (940-71-6) |
Description and Uses
Phosphonitrilic chloride trimer is a reagent for the synthesis of ″dandelion″ (spherical) dendrimers, can be used in ring-opening polymerization, ligand and/or ligand precursor for transition metals, and the study of P-Cl bond substitution reactions are among the interesting uses for this product.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 14-34-20/21/22 |
| Safety Statements | 26-36/37/39-45-7/8-41 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 28530090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





