A6672312
Phenidone B , Photography level, 98.5% , 2654-57-1
CAS NO.：2654-57-1
Empirical Formula: C10H12N2O
Molecular Weight: 176.22
MDL number: MFCD00044800
EINECS: 220-180-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB318.40 | In Stock |
|
| 500G | RMB1036.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-136 °C |
| Boiling point: | 307.83°C (rough estimate) |
| Density | 1.1102 (rough estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.7110 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.54±0.70(Predicted) |
| color | White to Light yellow |
| Water Solubility | 754.801mg/L at 30℃ |
| InChI | InChI=1S/C10H12N2O/c1-8-7-12(11-10(8)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,13) |
| InChIKey | ZZEYCGJAYIHIAZ-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)CC(C)C(=O)N1 |
| LogP | 0.624 at 25℃ |
| CAS DataBase Reference | 2654-57-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyrazolidinone, 4-methyl-1-phenyl- (2654-57-1) |
Description and Uses
1-Phenyl-4-methyl-3-pyrazolidone is used as imaging chemicals, used as photographic developers in photosensitive materials, black and white film and photographic paper, and also as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-51/53 |
| Safety Statements | 24/25 |
| RIDADR | 2811 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29331990 |
| REACH Registrations | Active |
