Pseudolaric Acid B , 98% , 82508-31-4
Synonym(s):
(-)-Pseudolaric acid B;O-Acetylpseudolaric acid C;Pseudolarix acid B
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB2242.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 166°C |
| Boiling point: | 466.14°C (rough estimate) |
| Density | 1.2108 (rough estimate) |
| refractive index | 1.4480 (estimate) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1mg/mL, clear, colorless |
| form | powder or crystals |
| pka | 4.52±0.19(Predicted) |
| color | white to off-white |
| InChIKey | VDGOFNMYZYBUDT-YCONPBHISA-N |
| SMILES | C1(=O)O[C@@](/C=C/C=C(/C(O)=O)\C)(C)[C@]2([H])CC[C@@]31CC=C(C(OC)=O)CC[C@@]32OC(C)=O |
Description and Uses
Pseudolaric acid B (PAB) is a diterpene acid isolated from the bark of P. kaempferi, a traditional Chinese medicinal plant. It has reported antifungal activities, consistent with its traditional use in the treatment of dermatological fungal infections. Moreover, PAB has diverse effects that are relevant to cancer therapy, including inducing apoptosis of cancer cells (IC50 = ~1 μM), preventing angiogenesis, and inhibiting tumor growth in vivo.
(-)-Pseudolaric Acid B is a diterpenoid posessing an immunomodulatory effect. It acts as an immunosuppressant in vitro/vivo however does show some cytotoxicity. Anti-tumor agent as well.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H361fd |
| Precautionary statements | P201-P301+P310+P330 |
| Hazard Codes | T |
| Risk Statements | 25-62 |
| Safety Statements | 36/37-45-24/25 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 2 |
| Hazardous Substances Data | 82508-31-4(Hazardous Substances Data) |







