A6687912
Potassium bis(trimethylsilyl)amide , 1MINTHF (about 22%content) , 40949-94-8
Synonym(s):
Hexamethyldisilazane potassium salt;Hexamethyldisilazane potassium salt solution;KHMDS;Potassium hexamethyldisilazide;Potassium hexamethyldisilazide solution
CAS NO.:40949-94-8
Empirical Formula: C6H18KNSi2
Molecular Weight: 199.48
MDL number: MFCD00010330
EINECS: 424-100-2
| Pack Size | Price | Stock | Quantity |
| 100ML | RMB102.40 | In Stock |
|
| 500ML | RMB568.80 | In Stock |
|
| 1L | RMB1012.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-195°C |
| Boiling point: | 111 °C |
| Density | 0.877 g/mL at 25 °C |
| vapor density | 3.2 (vs air) |
| vapor pressure | 54 mm Hg ( 25 °C) |
| refractive index | 1.4920 |
| Flash point: | 45 °F |
| storage temp. | Refrigerator |
| solubility | Miscible with terahydrofuran, ether, benzene and toluene. |
| form | Liquid |
| Specific Gravity | 0.877 |
| color | clear to slightly hazy yellow |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 4006754 |
| InChI | 1S/C6H18NSi2.K/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | IUBQJLUDMLPAGT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([K])[Si](C)(C)C |
| CAS DataBase Reference | 40949-94-8(CAS DataBase Reference) |
| EPA Substance Registry System | Silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, potassium salt (1:1) (40949-94-8) |
Description and Uses
Potassium Hexamethyldisilazide is widely used as a Sterically Hindered Base for Enolate Generation in Selective Formation of Linear Conjugated Dienolates and Alkyl (Z)-3-Alkenoates.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,F,Xn |
| Risk Statements | 14-34-67-65-63-48/20-11-40-36/37/38-19-37 |
| Safety Statements | 26-36/37/39-45-62-43-46-16-36/37 |
| RIDADR | UN 3263 8/PG 3 |
| WGK Germany | 3 |
| F | 1-3-10 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





