A6692012
Pyridaben , Analysis standard product, 99% , 96489-71-3
CAS NO.:96489-71-3
Empirical Formula: C19H25ClN2OS
Molecular Weight: 364.93
MDL number: MFCD00274601
EINECS: 405-700-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-112° |
| Boiling point: | 429.9±55.0 °C(Predicted) |
| Density | 1.2 g/cm3 |
| storage temp. | 0-6°C |
| solubility | Chloroform: Slightly Soluble |
| form | Solid |
| pka | -2.69±0.20(Predicted) |
| color | Off-white to light yellow |
| Merck | 13,8057 |
| BRN | 7933972 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C19H25ClN2OS/c1-18(2,3)14-9-7-13(8-10-14)12-24-15-11-21-22(19(4,5)6)17(23)16(15)20/h7-11H,12H2,1-6H3 |
| InChIKey | DWFZBUWUXWZWKD-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C(C)(C)C)N=CC(SCC2=CC=C(C(C)(C)C)C=C2)=C1Cl |
| LogP | 6.370 |
| CAS DataBase Reference | 96489-71-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridaben(96489-71-3) |
| EPA Substance Registry System | Pyridaben (96489-71-3) |
Description and Uses
Pyridaben is a pyridazinone derivative used as an acaricide.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H410 |
| Precautionary statements | P261-P264-P270-P273-P301+P310-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T;N,N,T |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 36/37-45-60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | UR6149000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 96489-71-3(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats, bobwhite quail, mallard ducks (mg/kg): 435, 358, >2250, >2500 orally (Hirata); LD50 in male, female rabbits (mg/kg): >2000, >2000 dermally (Hirata) |




