A6697812
Polyvinylpyrrolidone , Average molecular weight 58000, k29-32 , 9003-39-8
Synonym(s):
‘Plasdone’;Polyvidone;Polyvinylpyrrolidone;Povidone;PVP
CAS NO.：9003-39-8
Empirical Formula: CH4
Molecular Weight: 16.0425
MDL number: MFCD00149016
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB27.20 | In Stock |
|
| 100G | RMB58.40 | In Stock |
|
| 500G | RMB160.00 | In Stock |
|
| 2.5KG | RMB471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 90-93 °C |
| Density | 1,69 g/cm3 |
| Tg | 175 |
| bulk density | 330kg/m3 |
| refractive index | (25) 1.5300 |
| refractive index | 1.5300 |
| storage temp. | 2-8°C |
| solubility | H2O: soluble100mg/mL |
| form | powder |
| color | White to yellow-white |
| PH | 3.0-5.0 |
| biological source | synthetic (oragnic) |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,7697 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Light sensitive. Hygroscopic. |
| InChI | InChI=1S/C8H15NO/c1-3-7(2)9-6-4-5-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | FAAHNQAYWKTLFD-UHFFFAOYSA-N |
| SMILES | N1(C(C)CC)C(=O)CCC1 |
| IARC | 3 (Vol. 19, Sup 7, 71) 1987 |
| EPA Substance Registry System | Polyvinylpyrrolidone (9003-39-8) |
Description and Uses
Polyvinylpyrrolidone has been used:
- to perform intracytoplasmic sperm injection procedure
- in the preparation of endophyte coating agent mixture, to coat creeping bentgrass seed
- as a component of prehybridization solution
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360D |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | TR8370000 |
| Autoignition Temperature | 440 °C |
| TSCA | Yes |
| HS Code | 39059990 |
| Hazardous Substances Data | 9003-39-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |
