A6700112
(-)-α-Pinene , StandardforGC,≥99.0% , 7785-26-4
Synonym(s):
(-)-alpha-Pinene;(1S)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene;(-)-α-Pinene;(1S)-(-)-α-Pinene;(1S)-(?)-α-Pinene
CAS NO.:7785-26-4
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00064145
EINECS: 232-077-3
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB156.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -64 °C(lit.) |
| alpha | -41.5 º (c=neat) |
| Boiling point: | 156-158 °C(lit.) |
| Density | 0.874 g/mL at 25 °C |
| vapor density | 4.7 (vs air) |
| vapor pressure | ~3 mm Hg ( 20 °C) |
| FEMA | 2902 | ALPHA-PINENE |
| refractive index | n |
| Flash point: | 90 °F |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| Odor | at 10.00 % in dipropylene glycol. sharp warm resinous fresh pine |
| Odor Type | herbal |
| biological source | Pinus spp. |
| optical activity | [α]22/D 42°, neat |
| explosive limit | 0.8%(V) |
| Water Solubility | INSOLUBLE |
| Merck | 14,7445 |
| JECFA Number | 1329 |
| BRN | 1903790 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | GRWFGVWFFZKLTI-UHFFFAOYSA-N |
| SMILES | [C@@H]21C([C@@H](C2)C(=CC1)C)(C)C |
| LogP | 4.48 at 37℃ |
| CAS DataBase Reference | 7785-26-4(CAS DataBase Reference) |
| NIST Chemistry Reference | (1s)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene(7785-26-4) |
| EPA Substance Registry System | 2-Pinene, (1S,5S)-(-)- (7785-26-4) |
Description and Uses
(1S)-(-)-alpha-Pinene is used in the preparation of hydroxy ketones such as hydroxycarvones.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H302-H304-H315-H317-H410 |
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P331 |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 10-36/37/38-43-50-65-51/53-20/21/22 |
| Safety Statements | 26-36/37-61-16-60 |
| RIDADR | UN 2368 3/PG 3 |
| WGK Germany | 1 |
| RTECS | DT 7000000 |
| F | 10 |
| Autoignition Temperature | 491 °F |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29021910 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








![(S)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole](https://img.chemicalbook.com/CAS/GIF/14769-73-4.gif)