A6703912
6,13-Pentacenequinone , 99% , 3029-32-1
Synonym(s):
6,13-Pentacenedione
| Pack Size | Price | Stock | Quantity |
| 1G | RMB255.20 | In Stock |
|
| 5G | RMB796.00 | In Stock |
|
| 25G | RMB2908.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 394 °C |
| Boiling point: | 388.73°C (rough estimate) |
| Density | 1.2343 (rough estimate) |
| refractive index | 1.5344 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | Yellow |
| Water Solubility | insoluble |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C22H12O2/c23-21-17-9-13-5-1-2-6-14(13)10-18(17)22(24)20-12-16-8-4-3-7-15(16)11-19(20)21/h1-12H |
| InChIKey | UFCVADNIXDUEFZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3C(=O)C4=CC5=CC=CC=C5C=C4C(=O)C=3C=C2C=C1 |
| NIST Chemistry Reference | 6,13-Pentacenedione(3029-32-1) |
Description and Uses
6,13-Pentacenequinone has been used in:
- deposition of 6,13-pentacenequinone thin films on n-Si substrates by thermal evaporation
- as precursor to diarylpentacenes, potential organic field-effect transitors
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29146990 |
