A6705212
2-Phenylindole , 99% , 948-65-2
Synonym(s):
NSC 15776;Stabilizer I
CAS NO.:948-65-2
Empirical Formula: C14H11N
Molecular Weight: 193.24
MDL number: MFCD00005608
EINECS: 213-436-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB113.60 | In Stock |
|
| 250G | RMB176.80 | In Stock |
|
| 500g | RMB319.20 | In Stock |
|
| 1kg | RMB557.60 | In Stock |
|
| 2.5kg | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C (lit.) |
| Boiling point: | 250 °C/10 mmHg (lit.) |
| Density | 1.1061 (rough estimate) |
| refractive index | 1.5850 (estimate) |
| Flash point: | 250°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | 16.80±0.30(Predicted) |
| form | Powder |
| color | Off-white to beige or slightly green |
| InChI | 1S/C14H11N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-10,15H |
| InChIKey | KLLLJCACIRKBDT-UHFFFAOYSA-N |
| SMILES | c1ccc(cc1)-c2cc3ccccc3[nH]2 |
| CAS DataBase Reference | 948-65-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Indole, 2-phenyl-(948-65-2) |
| EPA Substance Registry System | 1H-Indole, 2-phenyl- (948-65-2) |
Description and Uses
Phenylindole is a stabilizer in PVC-plastic products (α-phenylindole).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335-H413 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| RTECS | NM1272500 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






