A6708912
Benzylideneacetone , >98.0%(GC) , 122-57-6
Synonym(s):
4-Phenyl-3-buten-2-one, Methyl styryl ketone, Benzalacetone;4-Phenylbut-3-en-2-one;Benzalacetone;Benzylideneacetone;Methyl styryl ketone
CAS NO.:122-57-6
Empirical Formula: C10H10O
Molecular Weight: 146.19
MDL number: MFCD00008779
EINECS: 204-555-1
| Pack Size | Price | Stock | Quantity |
| 100G | RMB38.40 | In Stock |
|
| 500G | RMB129.60 | In Stock |
|
| 2.5kg | RMB440.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-42 °C(lit.) |
| Boiling point: | 260-262 °C(lit.) |
| Density | 1.038 |
| vapor pressure | 0.01 mm Hg ( 25 °C) |
| FEMA | 2881 | 4-PHENYL-3-BUTEN-2-ONE |
| refractive index | 1.5836 |
| Flash point: | 150 °F |
| storage temp. | Store at <= 20°C. |
| solubility | Soluble in alcohol, chloroform, diethyl ether. |
| form | Low Melting Solid |
| color | Pale yellow to yellow |
| Odor | Sweet, but rather pungent odor with a creamy-floral note. |
| biological source | synthetic |
| Odor Type | spicy |
| Water Solubility | 1.398g/L(25 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,1137 |
| JECFA Number | 820 |
| BRN | 742046 |
| Stability: | Light Sensitive |
| InChI | 1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
| InChIKey | BWHOZHOGCMHOBV-BQYQJAHWSA-N |
| SMILES | [H]\C(=C(\[H])c1ccccc1)C(C)=O |
| LogP | 2.04 |
| CAS DataBase Reference | 122-57-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Buten-2-one, 4-phenyl-(122-57-6) |
| EPA Substance Registry System | Benzylideneacetone (122-57-6) |
Description and Uses
In perfumery, organic syntheses.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-43-42/43 |
| Safety Statements | 7-26-36/37/39-45-37/39-24-36/37-22 |
| WGK Germany | 3 |
| RTECS | EN0330050 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29143900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 Skin Sens. 1 |
| Toxicity | LD50 orally in Rabbit: 2031 mg/kg |







