A6719612
MES Potassium salt , 99% , 39946-25-3
Synonym(s):
2-(N-Morpholino)ethanesulfonic acid potassium salt;4-Morpholineethanesulfonic acid potassium salt
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB428.00 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.35 g/mL, clear, colorless |
| form | crystalline powder |
| pka | 6.1 |
| color | White to off-white |
| PH | 5.5-6.7 |
| PH Range | 5.5 - 6.7 |
| Water Solubility | water: 0.33g/mL, clear, colorless |
| InChI | 1S/C6H13NO4S.K/c8-12(9,10)6-3-7-1-4-11-5-2-7;/h1-6H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | IMFIKFZWLAWMQE-UHFFFAOYSA-M |
| SMILES | [K+].[O-]S(=O)(=O)CCN1CCOCC1 |
| CAS DataBase Reference | 39946-25-3(CAS DataBase Reference) |
Description and Uses
MES potassium salt has been used as a component of buffers for the preparation of permeabilized fiber bundles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
