A6720712
L-Proline benzyl ester hydrochloride , 98% , 16652-71-4
CAS NO.：16652-71-4
Empirical Formula: C12H16ClNO2
Molecular Weight: 241.71
MDL number: MFCD00039002
EINECS: 240-700-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB90.40 | In Stock |
|
| 100G | RMB288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-151 °C(lit.) |
| alpha | -44 º (c=1, methanol) |
| refractive index | 1.4365 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | White to pale yellow |
| optical activity | [α]20/D 48°, c = 1 in H2O |
| Water Solubility | miscible |
| Sensitive | Hygroscopic |
| BRN | 3598081 |
| InChI | InChI=1/C12H15NO2.ClH/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10;/h1-3,5-6,11,13H,4,7-9H2;1H/t11-;/s3 |
| InChIKey | NEDMOHHWRPHBAL-MERQFXBCSA-N |
| SMILES | [C@@H]1(NCCC1)C(=O)OCC1=CC=CC=C1.Cl |&1:0,r| |
| CAS DataBase Reference | 16652-71-4(CAS DataBase Reference) |
Description and Uses
L-Proline Benzyl Ester Hydrochloride acts as a reagent in the synthesis and bioactivity of a goralatide analog with anti-leukemic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
