PRODUCT Properties
| Melting point: | 174-176 °C |
| storage temp. | Store at RT. |
| solubility | Soluble in water, ethyl acetate, methyl acetate, ethylene glycol; slightly soluble in ethanol, methanol, methyl cellosolve |
| Colour Index | 45010 |
| form | crystals |
| color | Green needles or |
| Water Solubility | water: 1mg/mL |
| Merck | 13,8096 |
| BRN | 3846969 |
| Biological Applications | Detecting apoptosis in live cells; determination of DNA,hydrogen peroxide,glucose; diagnosis of diseases related to amyloid accumulation; urinary tract infection; treating protozoan infections in fish |
| InChI | InChI=1S/C21H27N2O.ClH/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18;/h9-15H,5-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SUVPQRYDMCNTPV-UHFFFAOYSA-J |
| SMILES | N(C1C=CC2=CC3=CC=C(N(CC)CC)C=C3[O+]=C2C=1)(CC)CC.[Cl-] |
| EPA Substance Registry System | Pyronine B (2150-48-3) |
Description and Uses
Pyronin B is used in the methyl green-pyronin method for coloration of nucleic acids. Pyronin B Ferric Chloride Complex is used in the methyl green-pyronin method for differential coloration of nucleic acids. Dyes and metabolites.
Safety
| Hazard Codes | Xn |
| Risk Statements | 68-40-20/21/22 |
| Safety Statements | 45-36/37-24/25-22-36 |
| WGK Germany | 3 |
| RTECS | BP6832000 |
| HS Code | 29329990 |
| Toxicity | mouse,LD50,intraperitoneal,15100ug/kg (15.1mg/kg),National Cancer Institute Screening Program Data Summary, Developmental Therapeutics Program. Vol. JAN1986, |
