A6722112
3-Piperidinecarboxylic acid , 98% , 498-95-3
Synonym(s):
(R)-(–)-Nipecotic acid;(±)-β-Homoproline;3-Carboxypiperidine;3-Piperidinecarboxylic acid;Hexahydronicotinic acid
CAS NO.：498-95-3
Empirical Formula: C6H11NO2
Molecular Weight: 129.16
MDL number: MFCD00005992
EINECS: 207-873-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB226.40 | In Stock |
|
| 500G | RMB916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261 °C (dec.) (lit.) |
| Boiling point: | 239.22°C (rough estimate) |
| Density | 1.1426 (rough estimate) |
| refractive index | 1.4587 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | water: soluble50mg/mL, clear, colorless to faintly yellow |
| pka | pK1:3.35(+1);pK2:10.64(0) (25°C) |
| form | Solid |
| color | White |
| Water Solubility | Soluble in water |
| Merck | 14,6560 |
| BRN | 81096 |
| InChI | InChI=1S/C6H11NO2/c8-6(9)5-2-1-3-7-4-5/h5,7H,1-4H2,(H,8,9) |
| InChIKey | XJLSEXAGTJCILF-UHFFFAOYSA-N |
| SMILES | N1CCCC(C(O)=O)C1 |
| CAS DataBase Reference | 498-95-3(CAS DataBase Reference) |
Description and Uses
(+/-)-Nipecotic Acid (cas# 498-95-3) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | TM6125380 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
