A6724612
DL-β-Phenylalanine , 98% , 614-19-7
Synonym(s):
β-Aminohydrocinnamic acid;DL -β-Homophenylglycine;DL -3-Amino-3-phenylpropionic acid;±-3-Amino-3-phenylpropionic acid
CAS NO.:614-19-7
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD00089905
EINECS: 210-371-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222 °C (dec.)(lit.) |
| Boiling point: | 293.03°C (rough estimate) |
| Density | 1.1603 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.45±0.12(Predicted) |
| form | Solid |
| color | White to Almost white |
| Water Solubility | SOLUBLE |
| BRN | 2803286 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey | UJOYFRCOTPUKAK-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(N)CC(=O)O |
| LogP | 0.211 (est) |
| CAS DataBase Reference | 614-19-7(CAS DataBase Reference) |
Description and Uses
DL-β-Phenylalanine is a useful synthetic intermediate. It was used in the synthesis of platelet aggregation inhibitors. It was also used as a reagent to synthesize human gonadotropin-releasing hormone receptor antagonists
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H317 |
| Precautionary statements | P501-P261-P272-P280-P302+P352-P362+P364-P333+P313-P305+P351+P338+P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |





