A6725312
3-Phenylglutaric acid , 98% , 4165-96-2
Synonym(s):
β-Phenylglutaric acid;3-Phenylpentanedioic acid
CAS NO.:4165-96-2
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00002718
EINECS: 224-016-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB399.20 | In Stock |
|
| 25G | RMB1599.20 | In Stock |
|
| 100G | RMB5584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 °C (lit.) |
| Boiling point: | 307.4°C (rough estimate) |
| Density | 1.2252 (rough estimate) |
| refractive index | 1.5020 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.06±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 2052171 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15) |
| InChIKey | RZOKZOYSUCSPDF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC(C1=CC=CC=C1)CC(O)=O |
| CAS DataBase Reference | 4165-96-2(CAS DataBase Reference) |
Description and Uses
3-Phenylglutaric Acid is useful in the synthesis of manganese catalysts for the stereoselective synthesis of cyclealkanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |



