PRODUCT Properties
| Melting point: | 75-80 °C(lit.) |
| Boiling point: | 120-130 °C |
| Density | 1.0149 (rough estimate) |
| refractive index | 1.6188 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder or Chunks |
| pka | 9.64(at 25℃) |
| color | White to yellow-beige |
| BRN | 1907938 |
| InChI | InChI=1S/C12H10O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,13H |
| InChIKey | UBXYXCRCOKCZIT-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC(O)=C1 |
| LogP | 3.230 |
| CAS DataBase Reference | 580-51-8(CAS DataBase Reference) |
| EPA Substance Registry System | m-Phenylphenol (580-51-8) |
Description and Uses
3 -Phenylphenol is a sensitive colorimetric reagent, used for the analysis of uronic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29071990 |






![16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione](https://img.chemicalbook.com/CAS/GIF/128-59-6.gif)
