A6731112
Propisochlor , Analysis standard product, 94% , 86763-47-5
Synonym(s):
2-Chloro-2′-ethyl-6′-methyl-N-(isopropoxymethyl)acetanilide;Proponit
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21.6 °C |
| Boiling point: | >243 °C |
| Density | 1.100±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate (Slightly) |
| pka | 1.30±0.50(Predicted) |
| color | Dark Yellow |
| Major Application | agriculture environmental |
| InChI | 1S/C15H22ClNO2/c1-5-13-8-6-7-12(4)15(13)17(14(18)9-16)10-19-11(2)3/h6-8,11H,5,9-10H2,1-4H3 |
| InChIKey | KZNDFYDURHAESM-UHFFFAOYSA-N |
| SMILES | CCc1cccc(C)c1N(COC(C)C)C(=O)CCl |
| LogP | 3.500 |
| CAS DataBase Reference | 86763-47-5(CAS DataBase Reference) |
Description and Uses
Propisochlor is an herbicide that is absorbed through the shoots of germinating plants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312 |
| Precautionary statements | P280 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 21 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal |
