A6735712
4′-Pentyl-4-biphenylcarbonitrile , 98% , 40817-08-1
Synonym(s):
4-Cyano-4-pentylbiphenyl;4-Pentyl-4-cyanobiphenyl;5CB
CAS NO.:40817-08-1
Empirical Formula: C18H19N
Molecular Weight: 249.35
MDL number: MFCD00036350
EINECS: 255-093-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB225.60 | In Stock |
|
| 100G | RMB796.00 | In Stock |
|
| 500g | RMB3368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34 °C |
| Boiling point: | 140-150 °C0.5 mm Hg(lit.) |
| Density | 1.008 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid crystal (nematic) |
| color | Off-White |
| Water Solubility | insoluble |
| InChI | InChI=1S/C18H19N/c1-2-3-4-5-15-6-10-17(11-7-15)18-12-8-16(14-19)9-13-18/h6-13H,2-5H2,1H3 |
| InChIKey | HHPCNRKYVYWYAU-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCCCC)C=C2)=CC=C(C#N)C=C1 |
| CAS DataBase Reference | 40817-08-1(CAS DataBase Reference) |
| NIST Chemistry Reference | [1,1'-Biphenyl]-4-carbonitrile, 4'-pentyl-(40817-08-1) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carbonitrile, 4'-pentyl- (40817-08-1) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-28-36-36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Sens. 1 |




