A6742812
Z-L-phenylalaninol , 98% , 6372-14-1
Synonym(s):
(S)-(−)-2-(Carbobenzyloxyamino)-3-phenyl-1-propanol;(S)-2-(Z-Amino)-3-phenyl-1-propanol;N-(Carbobenzyloxy)-L -phenylalaninol
CAS NO.：6372-14-1
Empirical Formula: C17H19NO3
Molecular Weight: 285.34
MDL number: MFCD00191138
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB73.60 | In Stock |
|
| 25G | RMB320.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C |
| alpha | -45 º (c=2, MeOH) |
| Boiling point: | 427.77°C (rough estimate) |
| Density | 1.0864 (rough estimate) |
| refractive index | -42 ° (C=2, MeOH) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 11.86±0.46(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 30°, c = 1 in chloroform |
| Water Solubility | insoluble |
| BRN | 2816420 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m0/s1 |
| InChIKey | WPOFMMJJCPZPAO-INIZCTEOSA-N |
| SMILES | OC[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 6372-14-1(CAS DataBase Reference) |
Description and Uses
Employed in the synthesis of biochemically active compounds. Building block for the synthesis of HIV protease inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29051990 |
| Storage Class | 11 - Combustible Solids |
