A6744712
pH standard-Borax , PH (25 ° C): 9.18 , 1330-43-4
Synonym(s):
Borax;Borax, fused;di-Sodium tetraborate;Sodium tetraborate
CAS NO.:1330-43-4
Empirical Formula: B4Na2O7
Molecular Weight: 201.22
MDL number: MFCD00081185
EINECS: 215-540-4
| Pack Size | Price | Stock | Quantity |
| 10×1EA | RMB183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 741 °C (lit.) |
| Boiling point: | 1575°C |
| bulk density | 700kg/m3 |
| Density | 2.367 g/mL at 25 °C (lit.) |
| vapor pressure | 7.3 hPa (1200 °C) |
| refractive index | 1.501 |
| Flash point: | 1575°C |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Solid |
| Specific Gravity | 2.367 |
| color | White |
| PH | 9.0-10.5 (25℃, 0.1M in H2O) |
| Water Solubility | 26 g/L (20 ºC) |
| Sensitive | Hygroscopic |
| λmax | λ: 260 nm Amax: ≤0.020 λ: 280 nm Amax: ≤0.015 |
| Merck | 14,8590 |
| Exposure limits | ACGIH: TWA 2 mg/m3; STEL 6 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with powdered metals. |
| Major Application | forensics and toxicology |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/B4O7.2Na/c5-1-7-3-9-2(6)10-4(8-1)11-3;;/q-2;2*+1 |
| InChIKey | UQGFMSUEHSUPRD-UHFFFAOYSA-N |
| SMILES | [Na+].[Na+].[O-]B1Ob2ob([O-])ob(O1)o2 |
| NIST Chemistry Reference | Sodium borate(1330-43-4) |
| EPA Substance Registry System | Sodium tetraborate (1330-43-4) |
Description and Uses
Refined borax (Na2B4O7) is an additive in laundry products such as soaps and water-softening compounds. Also used for cosmetics, body powders, and the manufacture of paper and leather. Borax is an environmentally safe natural herbicide and insecticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H319-H360FD |
| Precautionary statements | P202-P264-P280-P305+P351+P338-P308+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 62-63-36/38-36/37/38-61-60 |
| Safety Statements | 36/37-24/25-26-36-23-45-53 |
| RIDADR | UN 1760 8/PG 2 |
| OEB | C |
| OEL | TWA: 1 mg/m3 |
| WGK Germany | 1 |
| RTECS | ED4588000 |
| F | 34 |
| TSCA | TSCA listed |
| HS Code | 28401100 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Repr. 1B |
| Hazardous Substances Data | 1330-43-4(Hazardous Substances Data) |






