A6749012
Palladium(II) trifluoroacetate , 98% , 42196-31-6
Synonym(s):
Pd(TFA)2;Trifluoroacetic acid palladium(II) salt
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB119.20 | In Stock |
|
| 250MG | RMB239.20 | In Stock |
|
| 1G | RMB687.20 | In Stock |
|
| 5G | RMB2599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~220 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in diethyl ether and acetone. Insoluble in benzene, chloroform and trifluoroacetic acid. |
| form | Powder |
| color | Brown |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C2HF3O2.Pd/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | WEJWWPJAIXRLIJ-UHFFFAOYSA-M |
| SMILES | FC(F)(F)C(=O)O[Pd]OC(=O)C(F)(F)F |
| CAS DataBase Reference | 42196-31-6(CAS DataBase Reference) |
Description and Uses
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| TSCA | No |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
