A6750412
N-(Phosphonomethyl)iminodiacetic acid hydrate , 95% , 5994-61-6
CAS NO.：5994-61-6
Empirical Formula: C5H10NO7P
Molecular Weight: 227.11
MDL number: MFCD00192401
EINECS: 227-824-5
| Pack Size | Price | Stock | Quantity |
| 250G | RMB295.20 | In Stock |
|
| 2.5kg | RMB639.20 | In Stock |
|
| 1KG | RMB799.20 | In Stock |
|
| 10kg | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215 °C (dec.)(lit.) |
| Boiling point: | 585.9±60.0 °C(Predicted) |
| Density | 1.792±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 45℃ |
| storage temp. | RT, protect from light |
| solubility | Aqueous Base (Slightly), Methanol (Slightly) |
| form | Crystalline |
| pka | 0.90±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 1795744 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H10NO7P/c7-4(8)1-6(2-5(9)10)3-14(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13) |
| InChIKey | AZIHIQIVLANVKD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)CP(O)(O)=O |
| CAS DataBase Reference | 5994-61-6(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonomethyliminodiacetic acid (5994-61-6) |
Description and Uses
N-(Carboxymethyl)-N-(phosphonomethyl)-glycine is used in surface modification of cobalt oxide nanoparticle to overcome any toxic effect while functioning as cancer antigen carrier.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H335 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 1 |
