A6752912
4-Pyrazolecarboxylic acid , 98% , 37718-11-9
CAS NO.:37718-11-9
Empirical Formula: C4H4N2O2
Molecular Weight: 112.09
MDL number: MFCD00011558
EINECS: 253-641-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25g | RMB224.80 | In Stock |
|
| 100g | RMB836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 282 °C (dec.)(lit.) |
| Boiling point: | 417.1±18.0 °C(Predicted) |
| Density | 1.524±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 3.81±0.10(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C4H4N2O2/c7-4(8)3-1-5-6-2-3/h1-2H,(H,5,6)(H,7,8) |
| InChIKey | IMBBXSASDSZJSX-UHFFFAOYSA-N |
| SMILES | N1C=C(C(O)=O)C=N1 |
| CAS DataBase Reference | 37718-11-9(CAS DataBase Reference) |
Description and Uses
4-Pyrazolecarboxylic acid was used in preparation of ethyl 4-pyrazolecarboxylate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-amine](https://img.chemicalbook.com/CAS/GIF/17899-48-8.gif)

