PRODUCT Properties
| Melting point: | 61-65 °C (lit.) |
| Boiling point: | 286 °C(lit.) |
| Density | 1.062 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 10.20±0.10(Predicted) |
| form | Powder |
| color | Yellow to brown |
| Water Solubility | Soluble in water. |
| BRN | 124508 |
| InChI | InChI=1S/C11H15N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-5,11-12H,6-9H2 |
| InChIKey | UTBULQCHEUWJNV-UHFFFAOYSA-N |
| SMILES | N1CCC(C2=CC=CC=C2)CC1 |
| CAS DataBase Reference | 771-99-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Phenylpiperidine(771-99-3) |
Description and Uses
4-Phenylpiperidine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xi,C,F |
| Risk Statements | 36/37/38-34-11-20/21/22 |
| Safety Statements | 26-36/37/39-45-37/39-36/37-16 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 3 |
| RTECS | TM2625000 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
