A6761212
                    3-Phenylphenol , 97% , 580-51-8
                            Synonym(s):
3-Hydroxybiphenyl
                            
                        
                CAS NO.:580-51-8
Empirical Formula: C12H10O
Molecular Weight: 170.21
MDL number: MFCD00002294
EINECS: 250-480-2
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB49.60 | In Stock | 
                                                 | 
                                        
| 5G | RMB175.20 | In Stock | 
                                                 | 
                                        
| 25g | RMB854.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 75-80 °C(lit.) | 
                                    
| Boiling point: | 120-130 °C | 
                                    
| Density | 1.0149 (rough estimate) | 
                                    
| refractive index | 1.6188 (estimate) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| form | Crystalline Powder or Chunks | 
                                    
| pka | 9.64(at 25℃) | 
                                    
| color | White to yellow-beige | 
                                    
| BRN | 1907938 | 
                                    
| InChI | InChI=1S/C12H10O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9,13H | 
                                    
| InChIKey | UBXYXCRCOKCZIT-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C2=CC=CC=C2)=CC=CC(O)=C1 | 
                                    
| LogP | 3.230 | 
                                    
| CAS DataBase Reference | 580-51-8(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | m-Phenylphenol (580-51-8) | 
                                    
Description and Uses
3 -Phenylphenol is a sensitive colorimetric reagent, used for the analysis of uronic acid.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36-37/39 | 
| WGK Germany | 3 | 
| HS Code | 29071990 | 






![16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione](https://img.chemicalbook.com/CAS/GIF/128-59-6.gif)
