2,3,4,5,6-Pentafluorobenzoyl chloride , 99% , 2251-50-5
Synonym(s):
Pentafluorobenzoic acid chloride;Perfluorobenzoyl chloride
CAS NO.:2251-50-5
Empirical Formula: C7ClF5O
Molecular Weight: 230.52
MDL number: MFCD00000657
EINECS: 218-842-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB238.40 | In Stock |
|
| 100G | RMB784.00 | In Stock |
|
| 500g | RMB3826.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 158-159 °C(lit.) |
| Density | 1.601 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | None |
| storage temp. | Store below +30°C. |
| solubility | soluble in Chloroform |
| form | Liquid |
| Specific Gravity | 1.601 |
| color | Clear colorless to light yellow |
| Water Solubility | decomposes |
| Sensitive | Lachrymatory |
| BRN | 2054397 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C7ClF5O/c8-7(14)1-2(9)4(11)6(13)5(12)3(1)10 |
| InChIKey | MYHOHFDYWMPGJY-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(c(F)c1F)C(Cl)=O |
| CAS DataBase Reference | 2251-50-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentafluorobenzoyl chloride(2251-50-5) |
Description and Uses
Pentafluorobenzoyl chloride is the acid chloride of pentafluorobenzoic acid. It is a sensitive derivatising reagent for the analysis of amines, amides and phenols by electron capture gas chromatography. It has a role as a chromatographic reagent. It is an acyl chloride and a perfluorinated compound. It derives from a pentafluorobenzoic acid.
2,3,4,5,6-Pentafluorobenzoyl chloride was used for derivatization of 5-androstenediol, testosterone, estradiol , dihydrotestosterone and estrone in a study to determine their serum levels. 2,3,4,5,6-Pentafluorobenzoyl chloride was used to derivatize dimethylamine(DMA) in study to develop a rapid and accurate GC–MS method for determination of DMA in human urine. 2,3,4,5,6-Pentafluorobenzoyl chloride was used in a study to detect the presence of Enterobacter cloacae in cultures of Leuconostoc mesenteroide by gas chromatography/mass spectrometry.
Pentafluorobenzoyl Chloride is a useful analytical reagent in the derivatization amphetamines as well as other primary amines.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive/Lachrymator |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




