PRODUCT Properties
| Boiling point: | 117-121°C 0,3mm |
| Density | 1.215 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 117-121°C/0.3mm |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate |
| form | Liquid |
| color | Clear colorless to brown |
| Water Solubility | Soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate. Not miscible in water. |
| BRN | 1212957 |
| InChI | InChI=1S/C10H10O3S/c1-3-8-13-14(11,12)10-6-4-9(2)5-7-10/h1,4-7H,8H2,2H3 |
| InChIKey | LMBVCSFXFFROTA-UHFFFAOYSA-N |
| SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)C#C |
Description and Uses
Propargyl p-toluenesulfonate can be used as an initiator in the synthesis of linear and cyclic poly(2-isopropyl-2-oxazoline)s by cationic ring-opening polymerization of 2-isopropyl-2-oxazoline.
It can also be used as a reagent to synthesize:
- 2-hydroxy-4-pentynoic acid by an alkylation reaction with diethyl 2-acetamidomalonate followed by subsequent hydrolysis, decarboxylation, diazotization, and hydroxylation reactions.
- Furan derivatives by Pd-catalyzed reaction with acylchromates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | XT7300000 |
| F | 4.10-10-21 |
| HS Code | 29041000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






