A6770412
1H,1H,2H-Perfluoro-1-dodecene , 97% , 30389-25-4
CAS NO.：30389-25-4
Empirical Formula: C12H3F21
Molecular Weight: 546.12
MDL number: MFCD00042346
EINECS: 250-173-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB137.60 | In Stock |
|
| 25G | RMB497.60 | In Stock |
|
| 100g | RMB1357.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 71-72°C 14mm |
| Density | 1,711 g/cm3 |
| refractive index | 1.303 |
| Flash point: | 71-72°C/14mm |
| form | low melting solid |
| Specific Gravity | 1.711 |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 2493721 |
| InChI | InChI=1S/C12H3F21/c1-2-3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33/h2H,1H2 |
| InChIKey | UCHSAVGOZUCXHC-UHFFFAOYSA-N |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 30389-25-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1h,1h,2h-Perfluoro-1-dodecene(30389-25-4) |
| EPA Substance Registry System | (Perfluorodecyl)ethylene (30389-25-4) |
Description and Uses
1H,1H,2H-Perfluoro-1-dodecene is used in preparation method of coating for surface modification of photoresist.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2903590090 |
