Perfluorooctane , 98% , 307-34-6
Synonym(s):
Octadecafluorooctane;Perfluorooctane fraction
CAS NO.:307-34-6
Empirical Formula: C8F18
Molecular Weight: 438.06
MDL number: MFCD00042083
EINECS: 206-199-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB173.60 | In Stock |
|
| 100G | RMB527.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | −25 °C(lit.) |
| Boiling point: | 103-106 °C(lit.) |
| Density | 1.766 g/mL at 25 °C(lit.) |
| vapor pressure | 30hPa at 25℃ |
| refractive index | n |
| Flash point: | 99-100°C |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 1.73 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1717142 |
| Dielectric constant | 1.8100000000000001 |
| Stability: | Stable. |
| Major Application | PFAS testing |
| InChI | 1S/C8F18/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)26 |
| InChIKey | YVBBRRALBYAZBM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| LogP | 666 at 25℃ |
| Surface tension | 14mN/m at 20°C |
| CAS DataBase Reference | 307-34-6(CAS DataBase Reference) |
| NIST Chemistry Reference | n-Perfluorooctane(307-34-6) |
| EPA Substance Registry System | Octane, octadecafluoro- (307-34-6) |
Description and Uses
Perfluorooctane is a fluorocarbon liquid, usually in the form of Perfluorooctane Sulfonate (PFOS). Perfluorooctane is not easily soluble in water, with a solubility of 10 ppm in water, while PFOS is soluble in water, with solubilities reported to be 570 mg/L and 519 mg/L (at 20°C) in pure water and 370 mg/L in fresh water; solubility decreases as the salt content of the water increases. Perfluorooctane and its derivatives are used in retinal detachment surgery and proliferative vitreoretinopathy preparations.
Perfluorooctane (CAS# 307-34-6) can be used as a moisture-proof and wear-resistant coating compound. It can also be used to surface coat structure of surgical prosthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-37/39-36-26 |
| WGK Germany | 3 |
| RTECS | RG9701000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29033990 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 ivn-mus: 240 mg/kg MIVRA6 8,320,74 |




