A6773212
N-Phenyl-o-phenylenediamine , 98% , 534-85-0
Synonym(s):
2-Aminodiphenylamine
CAS NO.：534-85-0
Empirical Formula: C12H12N2
Molecular Weight: 184.24
MDL number: MFCD00007685
EINECS: 208-606-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB284.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-80 °C(lit.) |
| Boiling point: | 108 °C / 0.4mmHg |
| Density | 1.1160 (rough estimate) |
| refractive index | 1.6266 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 4.45±0.10(Predicted) |
| color | Pink-violet or gray-brown |
| Water Solubility | Soluble in acetone, chloroform and benzene. Insoluble in water. |
| BRN | 908984 |
| InChI | InChI=1S/C12H12N2/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H,13H2 |
| InChIKey | NFCPRRWCTNLGSN-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=CC=C1N |
| CAS DataBase Reference | 534-85-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenediamine, n-phenyl-(534-85-0) |
| EPA Substance Registry System | 1,2-Benzenediamine, N-phenyl- (534-85-0) |
Description and Uses
N-Phenyl-o-phenylenediamine is also used as an intermediate in organic synthesis and pharmaceuticals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/22-38-36/37/38 |
| Safety Statements | 22-24-28A-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29215990 |
