A6774112
Pyridine-2-boronic acid(contains varying amounts of Anhydride) , 95% , 197958-29-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB100.00 | In Stock |
|
| 1G | RMB378.40 | In Stock |
|
| 5G | RMB1263.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 |
| Boiling point: | 308.8±34.0 °C(Predicted) |
| Density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | 7.79±0.53(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H6BNO2/c8-6(9)5-3-1-2-4-7-5/h1-4,8-9H |
| InChIKey | UMLDUMMLRZFROX-UHFFFAOYSA-N |
| SMILES | C1(B(O)O)=NC=CC=C1 |
| CAS DataBase Reference | 197958-29-5(CAS DataBase Reference) |
Description and Uses
2-Pyridineboronic Acid is used in organic synthesis as a reagent in Suzuki cross-coupling reactions, for example in the synthesis of aryl- and heteroaryl-substituted 3-benzyloxyisothiazoles and novel fluorescent 3-aryl- and 3-methyl-7-aryl-[1,2,3]triazolo[1,5-a]pyridines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold under -20C |
| HS Code | 2933399990 |
