A6774812
2,6-Pyridinedicarboxaldehyde , >97.0%(GC) , 5431-44-7
CAS NO.:5431-44-7
Empirical Formula: C7H5NO2
Molecular Weight: 135.12
MDL number: MFCD00010103
EINECS: 226-589-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1G | RMB143.20 | In Stock |
|
| 5G | RMB639.20 | In Stock |
|
| 25g | RMB2919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-125 °C (lit.) |
| Boiling point: | 152-154 °C/103 mmHg (lit.) |
| Density | 1.3124 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 1.84±0.10(Predicted) |
| color | White to tan |
| InChI | InChI=1S/C7H5NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-5H |
| InChIKey | PMWXGSWIOOVHEQ-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC(C=O)=CC=C1 |
| CAS DataBase Reference | 5431-44-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Pyridinedicarboxaldehyde(5431-44-7) |
Description and Uses
2,6-Pyridinedicarboxaldehyde has been used in preparation of:
- functionalized resin Amberlite XAD-4
- boron-dipyrromethene (BODIPY)-based fluorescence probe with a N,N′-(pyridine-2, 6-diylbis(methylene))-dianiline substituent
- novel N-heterocyclic chitosan aerogel derivatives
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







