A6782312
4-Phenoxybenzoic Acid , 99% , 2215-77-2
CAS NO.:2215-77-2
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00002539
EINECS: 218-682-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 100G | RMB234.40 | In Stock |
|
| 500g | RMB881.60 | In Stock |
|
| 2.5kg | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-165 °C (lit.) |
| Boiling point: | 314.35°C (rough estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very faint turbidity in hot methanol. |
| form | Crystalline Powder |
| pka | 4.57(at 25℃) |
| color | White to slightly yellow |
| Sensitive | Air Sensitive |
| BRN | 2212463 |
| InChI | 1S/C13H10O3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H,(H,14,15) |
| InChIKey | RYAQFHLUEMJOMF-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Oc2ccccc2)cc1 |
| CAS DataBase Reference | 2215-77-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 4-phenoxy-(2215-77-2) |
| EPA Substance Registry System | Benzoic acid, 4-phenoxy- (2215-77-2) |
Description and Uses
4-Phenoxybenzoic acid can block DNA binding of the human papillomarvirus (HPV) E2 protein. It is employed as an intermediate of Sitafloxacin, which is a fluoroquinolone antibiotic that shows promise in the treatment of Buruli ulcer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36 |
| WGK Germany | 3 |
| RTECS | DH6293620 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | TDLo ivn-rat: 10,711 mg/kg BIPBU* 25,686,2002 |






![tert-butyl 4-(3-cyano-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl)piperidine-1-carboxylate](https://img.chemicalbook.com/CAS/20200331/GIF/2190506-56-8.gif)
