A6787012
Pelitinib , ≥98% , 257933-82-7
Synonym(s):
(2E)-N-[4-[(3-Chloro-4-fluorophenyl)amino]-3-cyano-7-ethoxy-6-quinolinyl]-4-(dimethylamino)-2-butenamide;EKB 569;EKB-569;WAY-EKB-569
CAS NO.：257933-82-7
Empirical Formula: C24H23ClFN5O2
Molecular Weight: 467.92
MDL number: MFCD09837868
EINECS: 803-625-4
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB551.20 | In Stock |
|
| 25MG | RMB714.40 | In Stock |
|
| 100MG | RMB2158.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-178°C |
| Boiling point: | 655.5±55.0 °C(Predicted) |
| Density | 1.34 |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| form | powder |
| pka | 12.23±0.43(Predicted) |
| color | white to beige |
| InChIKey | WVUNYSQLFKLYNI-AATRIKPKSA-N |
| SMILES | Fc1c(cc(cc1)Nc2c3c(ncc2C#N)cc(c(c3)NC(=O)\C=C\CN(C)C)OCC)Cl |
Description and Uses
Pelitinib is a cyanoquinoline that irreversibly inhibits the EGFR receptor tyrosine kinase (IC50 = 39 nM). It inhibits HER2 with a much weaker potency (IC50 = 1.2 μM). By disrupting Akt and MAPK pathways, pelitinib can induce apoptosis and suppress the growth of tumor cell lines, displaying particularly strong efficacy against hepatocellular carcinoma cells (IC50s = ~2 μM).
Labelled Pelitinib (P218702). A tyrosine kinase inhibitor; it is used to prepare formulation for treating primary or secondary cancer.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933.59.8000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
