A6790912
PF-562271 , ≥98% , 717907-75-0
CAS NO.:717907-75-0
Empirical Formula: C21H20F3N7O3S
Molecular Weight: 507.49
MDL number: MFCD16038299
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB719.20 | In Stock |
|
| 10MG | RMB1119.20 | In Stock |
|
| 100MG | RMB1368.00 | In Stock |
|
| 50MG | RMB3439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >204°C (dec.) |
| Density | 1.540 |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | White powder. |
| pka | 13.66±0.20(Predicted) |
| color | White to Off-White |
| InChIKey | MZDKLVOWGIOKTN-UHFFFAOYSA-N |
| SMILES | CS(N(C1=NC=CC=C1CNC1C(C(F)(F)F)=CN=C(NC2C=CC3=C(C=2)CC(=O)N3)N=1)C)(=O)=O |
Description and Uses
PF-56227 is a potent, ATP-competitive, reversible inhibitor of focal adhesion kinase (FAK). Potent FAK inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |







