A6805612
                    PCB No 209 solution , 100ug/mLinIsooctane , 2051-24-3
                            Synonym(s):
2,2′,3,3′,4,4′,5,5′,6,6′-PCB;Decachlorobiphenyl;Decachlorobiphenyl solution
                            
                        
                CAS NO.:2051-24-3
Empirical Formula: C12Cl10
Molecular Weight: 498.66
MDL number: MFCD00055243
EINECS: 218-115-1
| Pack Size | Price | Stock | Quantity | 
| 1ML | RMB167.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 310℃ | 
                                    
| Boiling point: | 566.2°C (rough estimate) | 
                                    
| Density | 1.8180 (rough estimate) | 
                                    
| refractive index | n/D1.3900-1.3940 | 
                                    
| Flash point: | 100 °C | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | 
                                    
| Water Solubility | 0.0006483ug/L(25 ºC) | 
                                    
| BRN | 2065289 | 
                                    
| InChI | InChI=1S/C12Cl10/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16 | 
                                    
| InChIKey | ONXPZLFXDMAPRO-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl)=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl | 
                                    
| EPA Substance Registry System | Decachlorobiphenyl (2051-24-3) | 
                                    
Description and Uses
2,2',3,3',4,4',5,5',6,6'-Decachlorobiphenyl is a polychlorinated biphenyl (PCB) congeners. A halogenated organic contaminant and a pesticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09  | 
                                    
| Signal word | Warning | 
| Hazard statements | H373-H410 | 
| Precautionary statements | P260-P273-P314-P391-P501 | 
| Hazard Codes | N,Xn,F,Xi | 
| Risk Statements | 33-50/53-67-65-38-11-66-36 | 
| Safety Statements | 35-60-61-62-26-33-29-16-9 | 
| RIDADR | 2315 | 
| WGK Germany | 3 | 
| HazardClass | 9 | 
| PackingGroup | II | 





