A6805612
PCB No 209 solution , 100ug/mLinIsooctane , 2051-24-3
Synonym(s):
2,2′,3,3′,4,4′,5,5′,6,6′-PCB;Decachlorobiphenyl;Decachlorobiphenyl solution
CAS NO.:2051-24-3
Empirical Formula: C12Cl10
Molecular Weight: 498.66
MDL number: MFCD00055243
EINECS: 218-115-1
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 310℃ |
| Boiling point: | 566.2°C (rough estimate) |
| Density | 1.8180 (rough estimate) |
| refractive index | n/D1.3900-1.3940 |
| Flash point: | 100 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Water Solubility | 0.0006483ug/L(25 ºC) |
| BRN | 2065289 |
| InChI | InChI=1S/C12Cl10/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16 |
| InChIKey | ONXPZLFXDMAPRO-UHFFFAOYSA-N |
| SMILES | C1(C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2Cl)=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl |
| EPA Substance Registry System | Decachlorobiphenyl (2051-24-3) |
Description and Uses
2,2',3,3',4,4',5,5',6,6'-Decachlorobiphenyl is a polychlorinated biphenyl (PCB) congeners. A halogenated organic contaminant and a pesticide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H410 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| Hazard Codes | N,Xn,F,Xi |
| Risk Statements | 33-50/53-67-65-38-11-66-36 |
| Safety Statements | 35-60-61-62-26-33-29-16-9 |
| RIDADR | 2315 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | II |





