A6809912
Primidone , ≥98%(HPLC) , 125-33-7
Synonym(s):
2-Desoxyphenobarbital;5-Ethyl-5-phenylhexahydropyrimidine-4,6-dione;Primidone
CAS NO.:125-33-7
Empirical Formula: C12H14N2O2
Molecular Weight: 218.25
MDL number: MFCD00038662
EINECS: 204-737-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB116.80 | In Stock |
|
| 25G | RMB314.40 | In Stock |
|
| 100G | RMB1094.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 281-282°C |
| Boiling point: | 358.94°C (rough estimate) |
| Density | 1.1402 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| Flash point: | 9℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Very slightly soluble in water, slightly soluble in ethanol (96 per cent). It dissolves in alkaline solutions. |
| form | Solid |
| pka | 12.26±0.40(Predicted) |
| color | White to Off-White |
| Water Solubility | <0.1 g/100 mL at 19 ºC |
| Merck | 14,7746 |
| BCS Class | 2 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | DQMZLTXERSFNPB-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NCNC1=O)c2ccccc2 |
| CAS DataBase Reference | 125-33-7(CAS DataBase Reference) |
| IARC | 2B (Vol. 108) 2016 |
| NIST Chemistry Reference | Primidone(125-33-7) |
| EPA Substance Registry System | Primidone (125-33-7) |
Description and Uses
Primidone is chemically and structurally similar to phenobarbital with the exception that the carbonyl group on C2 is replaced by a methylene group. This modification leads to the production of a drug with strong anticonvulsant properties without expressed soporific effects.
Primidone is an Anticonvulsant.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351-H361d |
| Precautionary statements | P201-P202-P264-P270-P301+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-40-39/23/24/25-23/24/25-11 |
| Safety Statements | 22-36-45-36/37-16-7 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | UV9100000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Repr. 2 |
| Hazardous Substances Data | 125-33-7(Hazardous Substances Data) |
| Toxicity | child,TDLo,oral,625mg/kg (625mg/kg),BEHAVIORAL: SLEEPBEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: GENERAL ANESTHETIC,British Medical Journal. Vol. 1, Pg. 90, 1957. |





