A6813612
Pilocarpine HCl , ≥99% , 54-71-7
Synonym(s):
(3S,4R)-4,5-Dihydro-3-ethyl-4-(1-methyl-1H-imidazol-5-ylmethyl)-2(3H)-furanone hydrochloride;Pilocarpine hydrochloride
CAS NO.:54-71-7
Empirical Formula: C11H17ClN2O2
Molecular Weight: 244.72
MDL number: MFCD00012722
EINECS: 200-212-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB92.00 | In Stock |
|
| 250MG | RMB319.20 | In Stock |
|
| 1G | RMB799.20 | In Stock |
|
| 5G | RMB2796.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-205 °C(lit.) |
| alpha | 89 º (C=5, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 100 mg/mL |
| form | powder |
| color | white |
| optical activity | +91.7 (H2O) |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Merck | 14,7424 |
| BRN | 4034491 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology veterinary |
| InChI | 1S/C11H16N2O2.ClH/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;/h5,7-8,10H,3-4,6H2,1-2H3;1H/t8-,10-;/m0./s1 |
| InChIKey | RNAICSBVACLLGM-GNAZCLTHSA-N |
| SMILES | Cl.CC[C@H]1[C@H](COC1=O)Cc2cncn2C |
| LogP | -0.095 (est) |
| CAS DataBase Reference | 54-71-7(CAS DataBase Reference) |
| EPA Substance Registry System | Pilocarpine monohydrochloride (54-71-7) |
Description and Uses
(+)-Pilocarpine hydrochloride is a muscarinic M1 and M2 acetylcholine receptor agonist with pKB values of 5 and 3.7, respectively. Systemic administration of (+)-Pilocarpine hydrochloride is typically used as an animal model for temporal lobe epilepsy and can mimic the generation of complex partial seizures by producing changes in hippocampal neuron morphology, membrane properties, and synaptic responses.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330 |
| Precautionary statements | P301+P310+P330-P304+P340+P310 |
| Hazard Codes | T+,T |
| Risk Statements | 26/28-25-23 |
| Safety Statements | 25-45 |
| RIDADR | UN 1544 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | TK1450000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29399990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |






