A6815612
Procarbazine HCl , ≥98% , 366-70-1
Synonym(s):
N-(1-Methylethyl)-4-[(2-methylhydrazinyl)methyl]benzamide hydrochloride
CAS NO.:366-70-1
Empirical Formula: C12H20ClN3O
Molecular Weight: 257.76
MDL number: MFCD00072082
EINECS: 206-678-6
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB47.20 | In Stock |
|
| 250MG | RMB86.40 | In Stock |
|
| 1G | RMB277.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223°C |
| Density | 8.3 g/cm3 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO: ≥18mg/mL |
| form | powder |
| color | white to tan |
| Water Solubility | >=10 g/100 mL at 21.5 ºC |
| Merck | 14,7758 |
| BCS Class | 3/1 |
| InChI | 1S/C12H19N3O.ClH/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3;/h4-7,9,13-14H,8H2,1-3H3,(H,15,16);1H |
| InChIKey | DERJYEZSLHIUKF-UHFFFAOYSA-N |
| SMILES | Cl.CNNCc1ccc(cc1)C(=O)NC(C)C |
| CAS DataBase Reference | 366-70-1(CAS DataBase Reference) |
| IARC | 2A (Vol. 26, Sup 7) 1987 |
| EPA Substance Registry System | Procarbazine hydrochloride (366-70-1) |
Description and Uses
Antineoplastic.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H341-H350-H360 |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-61-22-68 |
| Safety Statements | 53-36/37-45 |
| WGK Germany | 3 |
| RTECS | XS4725000 |
| HS Code | 2928002500 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Muta. 2 Repr. 1A |
| Toxicity | LD50 orally in rats: 785 ±34 mg/kg (Goldenthal) |







