A6817312
Palladium nitrate hydrate , Pd4-5%w/w(cont.Pd) , 10102-05-3
CAS NO.:10102-05-3
Empirical Formula: HNO3Pd
Molecular Weight: 169.43
MDL number: MFCD00011169
EINECS: 233-265-8
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB191.20 | In Stock |
|
| 5ML | RMB639.20 | In Stock |
|
| 25ML | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.118 g/mL at 25 °C |
| storage temp. | 15-25°C |
| solubility | Soluble in dilute nitric acid. |
| form | Crystals |
| color | Red-brown |
| Specific Gravity | 1.118 |
| PH | 0.5 (20°C in H2O) |
| Water Solubility | Soluble in water, nitric acid. |
| Sensitive | Hygroscopic |
| Merck | 13,7060 |
| Exposure limits | ACGIH: TWA 2 ppm; STEL 4 ppm OSHA: TWA 2 ppm(5 mg/m3) NIOSH: IDLH 25 ppm; TWA 2 ppm(5 mg/m3); STEL 4 ppm(10 mg/m3) |
| InChI | InChI=1S/HNO3.Pd/c2-1(3)4;/h(H,2,3,4); |
| InChIKey | GPNDARIEYHPYAY-UHFFFAOYSA-N |
| SMILES | N(O)(=O)=O.[Pd] |
| CAS DataBase Reference | 10102-05-3(CAS DataBase Reference) |
| EPA Substance Registry System | Nitric acid, palladium(2+) salt (10102-05-3) |
Description and Uses
Palladium matrix modifier may be used in determination of total arsenic by in situ oxidation of diluted urine using graphite furnace atomic absorption spectrophotometer.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS03,GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H271-H290-H314-H332-H411 |
| Precautionary statements | P210-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi,O |
| Risk Statements | 34-36/37/38-8 |
| Safety Statements | 26-36/37/39-45-17 |
| RIDADR | UN 3264 8/PG 2 |
| WGK Germany | 3 |
| RTECS | QV0560000 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | II |







