1-Pyrenecarboxaldehyde , 99% , 3029-19-4
Synonym(s):
1-Formylpyrene;1-Pyrenealdehyde;1-Pyrenecarbaldehyde;3-Pyrenylaldehyde
CAS NO.：3029-19-4
Empirical Formula: C17H10O
Molecular Weight: 230.26
MDL number: MFCD00004139
EINECS: 221-196-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 123-126 °C (lit.) |
| Boiling point: | 312.25°C (rough estimate) |
| Density | 1.1350 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1874889 |
| InChI | InChI=1S/C17H10O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-10H |
| InChIKey | RCYFOPUXRMOLQM-UHFFFAOYSA-N |
| SMILES | C1(C=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| CAS DataBase Reference | 3029-19-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Pyrene-carboxaldehyde(3029-19-4) |
Description and Uses
1-Pyrenecarboxaldehyde (PCA) is a bifunctional molecule containing a pyrene moiety and an aldehyde group. PCA can serve as a reducing agent capable of replacing toxic hydrazine in the chemical reduction of graphene oxide (GO). Numerous PCA molecules can be adsorbed onto the GO surface via strong π–π stacking and hydrophobic interactions between the pyrene moiety and the graphite plane. This successfully removes most of the oxygen-containing groups (such as epoxy and alkoxy groups) from the GO, thereby restoring the conjugated structure and electrical conductivity of graphene[6].
A novel base-discriminating fluorescent (BDF) compound: a highly polarity-sensitive fluorophore for SNP typing.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | UR2450200 |
| F | 10 |
| HS Code | 29122990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
