A6826212
Pelargonidin chloride , >97% , 134-04-3
Synonym(s):
3,4′,5,7-Tetrahydroxyflavylium chloride;3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride;Pelargonidol chloride
CAS NO.：134-04-3
Empirical Formula: C15H11ClO5
Molecular Weight: 306.7
MDL number: MFCD00017589
EINECS: 205-127-7
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB1039.20 | In Stock |
|
| 25MG | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >349.85°C |
| Boiling point: | 421.26°C (rough estimate) |
| Density | 1.3164 (rough estimate) |
| refractive index | 1.4429 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Red to brown solid. |
| color | Very Dark Brown |
| Merck | 13,7142 |
| BRN | 3922945 |
| InChI | InChI=1S/C15H10O5.ClH/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15;/h1-7H,(H3-,16,17,18,19);1H |
| InChIKey | YPVZJXMTXCOTJN-UHFFFAOYSA-N |
| SMILES | C12C(O)=CC(O)=CC1=[O+]C(C1=CC=C(O)C=C1)=C(O)C=2.[Cl-] |
| CAS DataBase Reference | 134-04-3(CAS DataBase Reference) |
Description and Uses
The aglucone of Pelargonin. Pelargonidin, an anthocyanidin, was tested for its antidiabetic potential.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H317 |
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338-P333+P313-P321-P337+P313-P363-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10-23 |
