A6829812
Poly(ethylene glycol) methyl ether acrylate , M.W.1000 , 32171-39-4
Synonym(s):
Acryl-PEG;Methoxy PEG acrylate;Methoxy poly(ethylene glycol) monoacrylate;mPEG-acrylate;Poly(ethylene glycol) monomethyl ether monoacrylate
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB104.80 | In Stock |
|
| 1G | RMB279.20 | In Stock |
|
| 5G | RMB852.80 | In Stock |
|
| 25G | RMB2232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 6-7 °C(lit.) |
| Density | 1.09 g/mL at 25 °C(lit.) |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| form | Granular Solid |
| color | White to off-white |
| Water Solubility | Soluble in water |
| α-end | methoxy |
| Ω-end | acrylate |
| InChI | InChI=1S/C6H10O3/c1-3-6(7)9-5-4-8-2/h3H,1,4-5H2,2H3 |
| InChIKey | HFCUBKYHMMPGBY-UHFFFAOYSA-N |
| SMILES | C(OCCOC)(=O)C=C |
| EPA Substance Registry System | Poly(oxy-1,2-ethanediyl), .alpha.-(1-oxo-2-propenyl)-.omega.-methoxy- (32171-39-4) |
Description and Uses
Polyethylene glycol methyl ether acrylate is used as a raw material in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H350 |
| Precautionary statements | P201-P308+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 45-46 |
| Safety Statements | 53-36/37/39-24/25-22-45 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 39072090 |
| Storage Class | 10 - Combustible liquids |



